| Name | 1,1-Dimethyl-3-phenylurea |
| Synonyms | PDU PDU(R) KAYRON Fenidin Fenuron FENURON DYBAR(R) DYHARD(R) UR 300 1,1-Dimethyl-3-phenylurea 1,1-DIMETHYL-3-PHENYLUREA |
| CAS | 101-42-8 |
| EINECS | 202-941-4 |
| InChI | InChI=1S/C9H12N2O/c1-11(2)9(12)10-8-6-4-3-5-7-8/h3-7H,1-2H3,(H,10,12) |
| Molecular Formula | C9H12N2O |
| Molar Mass | 164.2 |
| Density | 1.1062 (rough estimate) |
| Melting Point | 131-133° |
| Boling Point | 291.67°C (rough estimate) |
| Flash Point | 2°C |
| Water Solubility | 2.40g/L(25 ºC) |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Vapor Presure | 0.002Pa at 60℃ |
| Appearance | neat |
| Color | White |
| Merck | 13,4037 |
| BRN | 2208535 |
| pKa | 15.09±0.70(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5373 (estimate) |
| Risk Codes | R36/37 - Irritating to eyes and respiratory system. R36 - Irritating to the eyes R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R11 - Highly Flammable |
| Safety Description | S24 - Avoid contact with skin. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S16 - Keep away from sources of ignition. |
| UN IDs | UN 1648 3/PG 2 |
| WGK Germany | 2 |
| RTECS | YT1450000 |
| HS Code | 29242990 |
| Toxicity | LD50 orally in rats: 7500 mg/kg (Bailey, White) |
| LogP | 0.98 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | is used to control woody plants and deep-rooted perennial weeds, the dosage is 2 ~ 30kR/ha |
| Production method | It is obtained by the reaction of phenyl isocyanate with dimethylamine or aniline with dimethylcarbamate chloride. |
| category | pesticide |
| toxicity classification | low toxicity |
| acute toxicity | oral-rat LD50: 6400 mg/kg; Oral-mouse LD50: 4700 mg/kg |
| flammability hazard characteristics | combustion produces toxic nitrogen oxide gas |
| storage and transportation characteristics | warehouse ventilation and low temperature drying; separate from food raw materials storage and transportation |
| fire extinguishing agent | dry powder, foam, sand |
| occupational standard | STEL 3 mg/m3 |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |